C7H16N2 — CID 143410890
(5S)-2,5-dimethyl-1,4-diazepane (PubChem CID 143410890) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (5S)-2,5-dimethyl-1,4-diazepane.
| Compound Name | (5S)-2,5-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 143410890 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (5S)-2,5-dimethyl-1,4-diazepane |
| SMILES | CC1CN[C@@H](C)CCN1 |
| InChI | InChI=1S/C7H16N2/c1-6-3-4-8-7(2)5-9-6/h6-9H,3-5H2,1-2H3/t6-,7?/m0/s1 |
| InChIKey | SNWRXYHBFWBLGR-PKPIPKONSA-N |
| XLogP | 0.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |