C8H19N3 — CID 66663266
2,5-dimethyl-1,4,7-triazonane (PubChem CID 66663266) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is 2,5-dimethyl-1,4,7-triazonane.
| Compound Name | 2,5-dimethyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 66663266 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 2,5-dimethyl-1,4,7-triazonane |
| SMILES | CC1CNCCNC(C)CN1 |
| InChI | InChI=1S/C8H19N3/c1-7-5-9-3-4-10-8(2)6-11-7/h7-11H,3-6H2,1-2H3 |
| InChIKey | IJZIRIYTYKTPNT-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |