About 2,5-dimethyl-1,4,7-triazonane
2,5-dimethyl-1,4,7-triazonane (PubChem CID 66663266) has the molecular formula C8H19N3
and a molecular weight of 157.26 g/mol. Its IUPAC name is 2,5-dimethyl-1,4,7-triazonane.
Molecular Properties
| Compound Name | 2,5-dimethyl-1,4,7-triazonane |
| PubChem CID | 66663266 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 2,5-dimethyl-1,4,7-triazonane |
| SMILES | CC1CNCCNC(C)CN1 |
| InChI | InChI=1S/C8H19N3/c1-7-5-9-3-4-10-8(2)6-11-7/h7-11H,3-6H2,1-2H3 |
| InChIKey | IJZIRIYTYKTPNT-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethyl-1,4,7-triazonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,4,7-triazonane?
The IUPAC name of 2,5-dimethyl-1,4,7-triazonane (CID 66663266) is 2,5-dimethyl-1,4,7-triazonane.
What is the SMILES notation for 2,5-dimethyl-1,4,7-triazonane?
The canonical SMILES for 2,5-dimethyl-1,4,7-triazonane is CC1CNCCNC(C)CN1.
What is the InChIKey of 2,5-dimethyl-1,4,7-triazonane?
The InChIKey is IJZIRIYTYKTPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3/c1-7-5-9-3-4-10-8(2)6-11-7/h7-11H,3-6H2,1-2H3.
What are the key properties of 2,5-dimethyl-1,4,7-triazonane?
2,5-dimethyl-1,4,7-triazonane has a molecular weight of 157.26 g/mol, XLogP of -0.45, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,4,7-triazonane is sourced from PubChem (CID 66663266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).