C14H33N5 — CID 70323374
(2S,5R,8S,11S)-2,5,8,11-tetramethyl-1,4,7,10,13-pentazacyclopentadecane (PubChem CID 70323374) has the molecular formula C14H33N5 and a molecular weight of 271.45 g/mol. Its IUPAC name is (2S,5R,8S,11S)-2,5,8,11-tetramethyl-1,4,7,10,13-pentazacyclopentadecane.
| Compound Name | (2S,5R,8S,11S)-2,5,8,11-tetramethyl-1,4,7,10,13-pentazacyclopentadecane |
|---|---|
| PubChem CID | 70323374 |
| Molecular Formula | C14H33N5 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.27 |
| IUPAC Name | (2S,5R,8S,11S)-2,5,8,11-tetramethyl-1,4,7,10,13-pentazacyclopentadecane |
| SMILES | C[C@@H]1CN[C@@H](C)CN[C@@H](C)CNCCN[C@@H](C)CN1 |
| InChI | InChI=1S/C14H33N5/c1-11-7-15-5-6-16-12(2)8-18-14(4)10-19-13(3)9-17-11/h11-19H,5-10H2,1-4H3/t11-,12-,13-,14+/m0/s1 |
| InChIKey | QEXUQRRGDZFLET-XDQVBPFNSA-N |
| XLogP | -0.50 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |