C7H16ClN — CID 55286237
2,5-dimethylpiperidine;hydrochloride (PubChem CID 55286237) has the molecular formula C7H16ClN and a molecular weight of 149.66 g/mol. Its IUPAC name is 2,5-dimethylpiperidine;hydrochloride.
| Compound Name | 2,5-dimethylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 55286237 |
| Molecular Formula | C7H16ClN |
| Molecular Weight | 149.66 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2,5-dimethylpiperidine;hydrochloride |
| SMILES | CC1CCC(C)NC1.Cl |
| InChI | InChI=1S/C7H15N.ClH/c1-6-3-4-7(2)8-5-6;/h6-8H,3-5H2,1-2H3;1H |
| InChIKey | ZBLZZASAHWIFBB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |