C6H14N2 — CID 124581989
(3R,6S)-6-methylpiperidin-3-amine (PubChem CID 124581989) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is (3R,6S)-6-methylpiperidin-3-amine.
| Compound Name | (3R,6S)-6-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 124581989 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (3R,6S)-6-methylpiperidin-3-amine |
| SMILES | C[C@H]1CC[C@@H](N)CN1 |
| InChI | InChI=1S/C6H14N2/c1-5-2-3-6(7)4-8-5/h5-6,8H,2-4,7H2,1H3/t5-,6+/m0/s1 |
| InChIKey | CEPZJYNJDFUBDR-NTSWFWBYSA-N |
| XLogP | 0.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |