About 2,7-dimethylazepan-4-amine
2,7-dimethylazepan-4-amine (PubChem CID 70340178) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 2,7-dimethylazepan-4-amine.
Molecular Properties
| Compound Name | 2,7-dimethylazepan-4-amine |
| PubChem CID | 70340178 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2,7-dimethylazepan-4-amine |
| SMILES | CC1CCC(N)CC(C)N1 |
| InChI | InChI=1S/C8H18N2/c1-6-3-4-8(9)5-7(2)10-6/h6-8,10H,3-5,9H2,1-2H3 |
| InChIKey | TYDODNOVOCBHAT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dimethylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylazepan-4-amine?
The IUPAC name of 2,7-dimethylazepan-4-amine (CID 70340178) is 2,7-dimethylazepan-4-amine.
What is the SMILES notation for 2,7-dimethylazepan-4-amine?
The canonical SMILES for 2,7-dimethylazepan-4-amine is CC1CCC(N)CC(C)N1.
What is the InChIKey of 2,7-dimethylazepan-4-amine?
The InChIKey is TYDODNOVOCBHAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-6-3-4-8(9)5-7(2)10-6/h6-8,10H,3-5,9H2,1-2H3.
What are the key properties of 2,7-dimethylazepan-4-amine?
2,7-dimethylazepan-4-amine has a molecular weight of 142.25 g/mol, XLogP of 0.86, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylazepan-4-amine is sourced from PubChem (CID 70340178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).