C5H12ClN — CID 135392273
(2S,4S)-2,4-dimethylazetidine;hydrochloride (PubChem CID 135392273) has the molecular formula C5H12ClN and a molecular weight of 121.61 g/mol. Its IUPAC name is (2S,4S)-2,4-dimethylazetidine;hydrochloride.
| Compound Name | (2S,4S)-2,4-dimethylazetidine;hydrochloride |
|---|---|
| PubChem CID | 135392273 |
| Molecular Formula | C5H12ClN |
| Molecular Weight | 121.61 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | (2S,4S)-2,4-dimethylazetidine;hydrochloride |
| SMILES | C[C@H]1C[C@H](C)N1.Cl |
| InChI | InChI=1S/C5H11N.ClH/c1-4-3-5(2)6-4;/h4-6H,3H2,1-2H3;1H/t4-,5-;/m0./s1 |
| InChIKey | HNDQBGXJXDSIMB-FHAQVOQBSA-N |
| XLogP | 1.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.61 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |