C7H16NP — CID 156867021
(2,6-dimethylpiperidin-4-yl)phosphane (PubChem CID 156867021) has the molecular formula C7H16NP and a molecular weight of 145.19 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-4-yl)phosphane.
| Compound Name | (2,6-dimethylpiperidin-4-yl)phosphane |
|---|---|
| PubChem CID | 156867021 |
| Molecular Formula | C7H16NP |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.10 |
| IUPAC Name | (2,6-dimethylpiperidin-4-yl)phosphane |
| SMILES | CC1CC(P)CC(C)N1 |
| InChI | InChI=1S/C7H16NP/c1-5-3-7(9)4-6(2)8-5/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | HZFJCHBIOYSNKM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|