About (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane
(1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane (PubChem CID 163910451) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane.
Molecular Properties
| Compound Name | (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane |
| PubChem CID | 163910451 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane |
| SMILES | CC1CC2C3C[C@@H]2C3N1 |
| InChI | InChI=1S/C8H13N/c1-4-2-5-6-3-7(5)8(6)9-4/h4-9H,2-3H2,1H3/t4?,5?,6-,7?,8?/m0/s1 |
| InChIKey | QRPOXCLGZUACJF-LTHVNZCTSA-N |
| XLogP | 1.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane?
The IUPAC name of (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane (CID 163910451) is (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane.
What is the SMILES notation for (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane?
The canonical SMILES for (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane is CC1CC2C3C[C@@H]2C3N1.
What is the InChIKey of (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane?
The InChIKey is QRPOXCLGZUACJF-LTHVNZCTSA-N. The full InChI is InChI=1S/C8H13N/c1-4-2-5-6-3-7(5)8(6)9-4/h4-9H,2-3H2,1H3/t4?,5?,6-,7?,8?/m0/s1.
What are the key properties of (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane?
(1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane has a molecular weight of 123.20 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-methyl-3-azatricyclo[4.2.0.02,7]octane is sourced from PubChem (CID 163910451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).