C7H15N2- — CID 171585831
4-methanidyl-2,6-dimethyl-1,3-diazinane (PubChem CID 171585831) has the molecular formula C7H15N2- and a molecular weight of 127.21 g/mol. Its IUPAC name is 4-methanidyl-2,6-dimethyl-1,3-diazinane.
| Compound Name | 4-methanidyl-2,6-dimethyl-1,3-diazinane |
|---|---|
| PubChem CID | 171585831 |
| Molecular Formula | C7H15N2- |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.12 |
| IUPAC Name | 4-methanidyl-2,6-dimethyl-1,3-diazinane |
| SMILES | [CH2-]C1CC(C)NC(C)N1 |
| InChI | InChI=1S/C7H15N2/c1-5-4-6(2)9-7(3)8-5/h5-9H,1,4H2,2-3H3/q-1 |
| InChIKey | FDLVHIJUTYGDSU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|