C6H17N3O — CID 156588362
2,4,6-trimethyl-1,3,5-triazinane;hydrate (PubChem CID 156588362) has the molecular formula C6H17N3O and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,4,6-trimethyl-1,3,5-triazinane;hydrate.
| Compound Name | 2,4,6-trimethyl-1,3,5-triazinane;hydrate |
|---|---|
| PubChem CID | 156588362 |
| Molecular Formula | C6H17N3O |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.14 |
| IUPAC Name | 2,4,6-trimethyl-1,3,5-triazinane;hydrate |
| SMILES | CC1NC(C)NC(C)N1.O |
| InChI | InChI=1S/C6H15N3.H2O/c1-4-7-5(2)9-6(3)8-4;/h4-9H,1-3H3;1H2 |
| InChIKey | UKVKUSPCQVEQAO-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |