C5H12N3Y- — CID 171048545
CID 171048545 (PubChem CID 171048545) has the molecular formula C5H12N3Y- and a molecular weight of 203.08 g/mol.
| Compound Name | CID 171048545 |
|---|---|
| PubChem CID | 171048545 |
| Molecular Formula | C5H12N3Y- |
| Molecular Weight | 203.08 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | — |
| SMILES | CC1N[CH-]NC(C)N1.[Y] |
| InChI | InChI=1S/C5H12N3.Y/c1-4-6-3-7-5(2)8-4;/h3-8H,1-2H3;/q-1; |
| InChIKey | JCLLHMSOZRAHSD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.08 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|