C4H14N6 — CID 148646488
5,8-dimethyl-1,2,3,4,6,7-hexazocane (PubChem CID 148646488) has the molecular formula C4H14N6 and a molecular weight of 146.20 g/mol. Its IUPAC name is 5,8-dimethyl-1,2,3,4,6,7-hexazocane.
| Compound Name | 5,8-dimethyl-1,2,3,4,6,7-hexazocane |
|---|---|
| PubChem CID | 148646488 |
| Molecular Formula | C4H14N6 |
| Molecular Weight | 146.20 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 5,8-dimethyl-1,2,3,4,6,7-hexazocane |
| SMILES | CC1NNNNC(C)NN1 |
| InChI | InChI=1S/C4H14N6/c1-3-5-6-4(2)8-10-9-7-3/h3-10H,1-2H3 |
| InChIKey | NLBAOABCVXFEEK-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.20 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |