C4H11N3 — CID 5231545
3,5-dimethyl-1,2,4-triazolidine (PubChem CID 5231545) has the molecular formula C4H11N3 and a molecular weight of 101.15 g/mol. Its IUPAC name is 3,5-dimethyl-1,2,4-triazolidine.
| Compound Name | 3,5-dimethyl-1,2,4-triazolidine |
|---|---|
| PubChem CID | 5231545 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | 3,5-dimethyl-1,2,4-triazolidine |
| SMILES | CC1NNC(C)N1 |
| InChI | InChI=1S/C4H11N3/c1-3-5-4(2)7-6-3/h3-7H,1-2H3 |
| InChIKey | NZJCGBDCEKHAJX-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |