C12H32N8 — CID 57459676
3,4,11,12-tetramethyl-1,2,5,6,9,10,13,14-octazacyclohexadecane (PubChem CID 57459676) has the molecular formula C12H32N8 and a molecular weight of 288.44 g/mol. Its IUPAC name is 3,4,11,12-tetramethyl-1,2,5,6,9,10,13,14-octazacyclohexadecane.
| Compound Name | 3,4,11,12-tetramethyl-1,2,5,6,9,10,13,14-octazacyclohexadecane |
|---|---|
| PubChem CID | 57459676 |
| Molecular Formula | C12H32N8 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.27 |
| IUPAC Name | 3,4,11,12-tetramethyl-1,2,5,6,9,10,13,14-octazacyclohexadecane |
| SMILES | CC1NNCCNNC(C)C(C)NNCCNNC1C |
| InChI | InChI=1S/C12H32N8/c1-9-10(2)18-14-7-8-16-20-12(4)11(3)19-15-6-5-13-17-9/h9-20H,5-8H2,1-4H3 |
| InChIKey | DHHSGLXKJPVDII-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |