About 3-propan-2-yldiazinane
3-propan-2-yldiazinane (PubChem CID 153427717) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is 3-propan-2-yldiazinane.
Molecular Properties
| Compound Name | 3-propan-2-yldiazinane |
| PubChem CID | 153427717 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 3-propan-2-yldiazinane |
| SMILES | CC(C)C1CCCNN1 |
| InChI | InChI=1S/C7H16N2/c1-6(2)7-4-3-5-8-9-7/h6-9H,3-5H2,1-2H3 |
| InChIKey | ZTHGRYGZDFLNRG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propan-2-yldiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yldiazinane?
The IUPAC name of 3-propan-2-yldiazinane (CID 153427717) is 3-propan-2-yldiazinane.
What is the SMILES notation for 3-propan-2-yldiazinane?
The canonical SMILES for 3-propan-2-yldiazinane is CC(C)C1CCCNN1.
What is the InChIKey of 3-propan-2-yldiazinane?
The InChIKey is ZTHGRYGZDFLNRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2/c1-6(2)7-4-3-5-8-9-7/h6-9H,3-5H2,1-2H3.
What are the key properties of 3-propan-2-yldiazinane?
3-propan-2-yldiazinane has a molecular weight of 128.22 g/mol, XLogP of 0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yldiazinane is sourced from PubChem (CID 153427717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).