About methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane
methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane (PubChem CID 159611359) has the molecular formula C14H31N
and a molecular weight of 213.41 g/mol. Its IUPAC name is methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane.
Molecular Properties
| Compound Name | methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane |
| PubChem CID | 159611359 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane |
| SMILES | C.CC(C)C1CCC1.CC(C)C1CCN1 |
| InChI | InChI=1S/C7H14.C6H13N.CH4/c1-6(2)7-4-3-5-7;1-5(2)6-3-4-7-6;/h6-7H,3-5H2,1-2H3;5-7H,3-4H2,1-2H3;1H4 |
| InChIKey | MMSQFCMSPFXHHK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane?
The IUPAC name of methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane (CID 159611359) is methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane.
What is the SMILES notation for methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane?
The canonical SMILES for methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane is C.CC(C)C1CCC1.CC(C)C1CCN1.
What is the InChIKey of methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane?
The InChIKey is MMSQFCMSPFXHHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C6H13N.CH4/c1-6(2)7-4-3-5-7;1-5(2)6-3-4-7-6;/h6-7H,3-5H2,1-2H3;5-7H,3-4H2,1-2H3;1H4.
What are the key properties of methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane?
methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane has a molecular weight of 213.41 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-propan-2-ylazetidine;propan-2-ylcyclobutane is sourced from PubChem (CID 159611359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).