About ethane;2-propan-2-ylpiperidine
ethane;2-propan-2-ylpiperidine (PubChem CID 154671868) has the molecular formula C12H29N
and a molecular weight of 187.37 g/mol. Its IUPAC name is ethane;2-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | ethane;2-propan-2-ylpiperidine |
| PubChem CID | 154671868 |
| Molecular Formula | C12H29N |
| Molecular Weight | 187.37 g/mol |
| Exact Mass | 187.23 |
| IUPAC Name | ethane;2-propan-2-ylpiperidine |
| SMILES | CC.CC.CC(C)C1CCCCN1 |
| InChI | InChI=1S/C8H17N.2C2H6/c1-7(2)8-5-3-4-6-9-8;2*1-2/h7-9H,3-6H2,1-2H3;2*1-2H3 |
| InChIKey | PQKVEFWDYQUHFY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-propan-2-ylpiperidine?
The IUPAC name of ethane;2-propan-2-ylpiperidine (CID 154671868) is ethane;2-propan-2-ylpiperidine.
What is the SMILES notation for ethane;2-propan-2-ylpiperidine?
The canonical SMILES for ethane;2-propan-2-ylpiperidine is CC.CC.CC(C)C1CCCCN1.
What is the InChIKey of ethane;2-propan-2-ylpiperidine?
The InChIKey is PQKVEFWDYQUHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.2C2H6/c1-7(2)8-5-3-4-6-9-8;2*1-2/h7-9H,3-6H2,1-2H3;2*1-2H3.
What are the key properties of ethane;2-propan-2-ylpiperidine?
ethane;2-propan-2-ylpiperidine has a molecular weight of 187.37 g/mol, XLogP of 3.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-propan-2-ylpiperidine is sourced from PubChem (CID 154671868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).