C12H27N — CID 157197776
(2S,6S)-2,6-di(propan-2-yl)piperidine;methane (PubChem CID 157197776) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is (2S,6S)-2,6-di(propan-2-yl)piperidine;methane.
| Compound Name | (2S,6S)-2,6-di(propan-2-yl)piperidine;methane |
|---|---|
| PubChem CID | 157197776 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | (2S,6S)-2,6-di(propan-2-yl)piperidine;methane |
| SMILES | C.CC(C)[C@@H]1CCC[C@@H](C(C)C)N1 |
| InChI | InChI=1S/C11H23N.CH4/c1-8(2)10-6-5-7-11(12-10)9(3)4;/h8-12H,5-7H2,1-4H3;1H4/t10-,11-;/m0./s1 |
| InChIKey | AQLHHCZHRFQMQS-ACMTZBLWSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |