C7H16N2 — CID 58473806
4-propan-2-yl-1,3-diazinane (PubChem CID 58473806) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is 4-propan-2-yl-1,3-diazinane.
| Compound Name | 4-propan-2-yl-1,3-diazinane |
|---|---|
| PubChem CID | 58473806 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 4-propan-2-yl-1,3-diazinane |
| SMILES | CC(C)C1CCNCN1 |
| InChI | InChI=1S/C7H16N2/c1-6(2)7-3-4-8-5-9-7/h6-9H,3-5H2,1-2H3 |
| InChIKey | IELPDYIZEFCEKQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |