C6H12N2O — CID 67472235
1-(1,3-diazinan-4-yl)ethanone (PubChem CID 67472235) has the molecular formula C6H12N2O and a molecular weight of 128.18 g/mol. Its IUPAC name is 1-(1,3-diazinan-4-yl)ethanone.
| Compound Name | 1-(1,3-diazinan-4-yl)ethanone |
|---|---|
| PubChem CID | 67472235 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 1-(1,3-diazinan-4-yl)ethanone |
| SMILES | CC(=O)C1CCNCN1 |
| InChI | InChI=1S/C6H12N2O/c1-5(9)6-2-3-7-4-8-6/h6-8H,2-4H2,1H3 |
| InChIKey | MXJGOTVGUQUONY-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |