C10H22N4O — CID 22113791
1-(1,4,7,10-tetrazacyclododec-2-yl)ethanone (PubChem CID 22113791) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(1,4,7,10-tetrazacyclododec-2-yl)ethanone.
| Compound Name | 1-(1,4,7,10-tetrazacyclododec-2-yl)ethanone |
|---|---|
| PubChem CID | 22113791 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 1-(1,4,7,10-tetrazacyclododec-2-yl)ethanone |
| SMILES | CC(=O)C1CNCCNCCNCCN1 |
| InChI | InChI=1S/C10H22N4O/c1-9(15)10-8-13-5-4-11-2-3-12-6-7-14-10/h10-14H,2-8H2,1H3 |
| InChIKey | HJGOZTZURVYSBA-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |