About acetic acid;piperazine-2-carboxamide
acetic acid;piperazine-2-carboxamide (PubChem CID 14877963) has the molecular formula C9H19N3O5
and a molecular weight of 249.27 g/mol. Its IUPAC name is acetic acid;piperazine-2-carboxamide.
Molecular Properties
| Compound Name | acetic acid;piperazine-2-carboxamide |
| PubChem CID | 14877963 |
| Molecular Formula | C9H19N3O5 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | acetic acid;piperazine-2-carboxamide |
| SMILES | CC(=O)O.CC(=O)O.NC(=O)C1CNCCN1 |
| InChI | InChI=1S/C5H11N3O.2C2H4O2/c6-5(9)4-3-7-1-2-8-4;2*1-2(3)4/h4,7-8H,1-3H2,(H2,6,9);2*1H3,(H,3,4) |
| InChIKey | WZSLIBXDOXFGDD-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze acetic acid;piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;piperazine-2-carboxamide?
The IUPAC name of acetic acid;piperazine-2-carboxamide (CID 14877963) is acetic acid;piperazine-2-carboxamide.
What is the SMILES notation for acetic acid;piperazine-2-carboxamide?
The canonical SMILES for acetic acid;piperazine-2-carboxamide is CC(=O)O.CC(=O)O.NC(=O)C1CNCCN1.
What is the InChIKey of acetic acid;piperazine-2-carboxamide?
The InChIKey is WZSLIBXDOXFGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O.2C2H4O2/c6-5(9)4-3-7-1-2-8-4;2*1-2(3)4/h4,7-8H,1-3H2,(H2,6,9);2*1H3,(H,3,4).
What are the key properties of acetic acid;piperazine-2-carboxamide?
acetic acid;piperazine-2-carboxamide has a molecular weight of 249.27 g/mol, XLogP of -1.79, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;piperazine-2-carboxamide is sourced from PubChem (CID 14877963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).