C8H17N5O2 — CID 83121811
N-[2-(carbamoylamino)ethyl]piperazine-2-carboxamide (PubChem CID 83121811) has the molecular formula C8H17N5O2 and a molecular weight of 215.26 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]piperazine-2-carboxamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 83121811 |
| Molecular Formula | C8H17N5O2 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]piperazine-2-carboxamide |
| SMILES | NC(=O)NCCNC(=O)C1CNCCN1 |
| InChI | InChI=1S/C8H17N5O2/c9-8(15)13-4-3-12-7(14)6-5-10-1-2-11-6/h6,10-11H,1-5H2,(H,12,14)(H3,9,13,15) |
| InChIKey | ZBCYODVHDXPHFT-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|