About acetic acid;piperazine-2-carboxamide
acetic acid;piperazine-2-carboxamide (PubChem CID 174786994) has the molecular formula C7H15N3O3
and a molecular weight of 189.21 g/mol. Its IUPAC name is acetic acid;piperazine-2-carboxamide.
Molecular Properties
| Compound Name | acetic acid;piperazine-2-carboxamide |
| PubChem CID | 174786994 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | acetic acid;piperazine-2-carboxamide |
| SMILES | CC(=O)O.NC(=O)C1CNCCN1 |
| InChI | InChI=1S/C5H11N3O.C2H4O2/c6-5(9)4-3-7-1-2-8-4;1-2(3)4/h4,7-8H,1-3H2,(H2,6,9);1H3,(H,3,4) |
| InChIKey | MHDRIPGMUMOZNK-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;piperazine-2-carboxamide?
The IUPAC name of acetic acid;piperazine-2-carboxamide (CID 174786994) is acetic acid;piperazine-2-carboxamide.
What is the SMILES notation for acetic acid;piperazine-2-carboxamide?
The canonical SMILES for acetic acid;piperazine-2-carboxamide is CC(=O)O.NC(=O)C1CNCCN1.
What is the InChIKey of acetic acid;piperazine-2-carboxamide?
The InChIKey is MHDRIPGMUMOZNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O.C2H4O2/c6-5(9)4-3-7-1-2-8-4;1-2(3)4/h4,7-8H,1-3H2,(H2,6,9);1H3,(H,3,4).
What are the key properties of acetic acid;piperazine-2-carboxamide?
acetic acid;piperazine-2-carboxamide has a molecular weight of 189.21 g/mol, XLogP of -1.88, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;piperazine-2-carboxamide is sourced from PubChem (CID 174786994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).