About piperazine-2-carboxylic acid
piperazine-2-carboxylic acid (PubChem CID 2723758) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is piperazine-2-carboxylic acid.
Molecular Properties
| Compound Name | piperazine-2-carboxylic acid |
| PubChem CID | 2723758 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CNCCN1 |
| InChI | InChI=1S/C5H10N2O2/c8-5(9)4-3-6-1-2-7-4/h4,6-7H,1-3H2,(H,8,9) |
| InChIKey | JSSXHAMIXJGYCS-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-2-carboxylic acid?
The IUPAC name of piperazine-2-carboxylic acid (CID 2723758) is piperazine-2-carboxylic acid.
What is the SMILES notation for piperazine-2-carboxylic acid?
The canonical SMILES for piperazine-2-carboxylic acid is O=C(O)C1CNCCN1.
What is the InChIKey of piperazine-2-carboxylic acid?
The InChIKey is JSSXHAMIXJGYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c8-5(9)4-3-6-1-2-7-4/h4,6-7H,1-3H2,(H,8,9).
What are the key properties of piperazine-2-carboxylic acid?
piperazine-2-carboxylic acid has a molecular weight of 130.15 g/mol, XLogP of -1.37, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-2-carboxylic acid is sourced from PubChem (CID 2723758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).