About azetidine-2-carboxylic acid;hydrochloride
azetidine-2-carboxylic acid;hydrochloride (PubChem CID 45358168) has the molecular formula C4H8ClNO2
and a molecular weight of 137.57 g/mol. Its IUPAC name is azetidine-2-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | azetidine-2-carboxylic acid;hydrochloride |
| PubChem CID | 45358168 |
| Molecular Formula | C4H8ClNO2 |
| Molecular Weight | 137.57 g/mol |
| Exact Mass | 137.02 |
| IUPAC Name | azetidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCN1 |
| InChI | InChI=1S/C4H7NO2.ClH/c6-4(7)3-1-2-5-3;/h3,5H,1-2H2,(H,6,7);1H |
| InChIKey | LPAHPJVNLPAUNC-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.57 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azetidine-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-2-carboxylic acid;hydrochloride?
The IUPAC name of azetidine-2-carboxylic acid;hydrochloride (CID 45358168) is azetidine-2-carboxylic acid;hydrochloride.
What is the SMILES notation for azetidine-2-carboxylic acid;hydrochloride?
The canonical SMILES for azetidine-2-carboxylic acid;hydrochloride is Cl.O=C(O)C1CCN1.
What is the InChIKey of azetidine-2-carboxylic acid;hydrochloride?
The InChIKey is LPAHPJVNLPAUNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.ClH/c6-4(7)3-1-2-5-3;/h3,5H,1-2H2,(H,6,7);1H.
What are the key properties of azetidine-2-carboxylic acid;hydrochloride?
azetidine-2-carboxylic acid;hydrochloride has a molecular weight of 137.57 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 45358168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).