About piperazine-2-carboxylic acid;quinoline
piperazine-2-carboxylic acid;quinoline (PubChem CID 160554290) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is piperazine-2-carboxylic acid;quinoline.
Molecular Properties
| Compound Name | piperazine-2-carboxylic acid;quinoline |
| PubChem CID | 160554290 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | piperazine-2-carboxylic acid;quinoline |
| SMILES | O=C(O)C1CNCCN1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C5H10N2O2/c1-2-6-9-8(4-1)5-3-7-10-9;8-5(9)4-3-6-1-2-7-4/h1-7H;4,6-7H,1-3H2,(H,8,9) |
| InChIKey | QYMAKZXFSZWANE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine-2-carboxylic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-2-carboxylic acid;quinoline?
The IUPAC name of piperazine-2-carboxylic acid;quinoline (CID 160554290) is piperazine-2-carboxylic acid;quinoline.
What is the SMILES notation for piperazine-2-carboxylic acid;quinoline?
The canonical SMILES for piperazine-2-carboxylic acid;quinoline is O=C(O)C1CNCCN1.c1ccc2ncccc2c1.
What is the InChIKey of piperazine-2-carboxylic acid;quinoline?
The InChIKey is QYMAKZXFSZWANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C5H10N2O2/c1-2-6-9-8(4-1)5-3-7-10-9;8-5(9)4-3-6-1-2-7-4/h1-7H;4,6-7H,1-3H2,(H,8,9).
What are the key properties of piperazine-2-carboxylic acid;quinoline?
piperazine-2-carboxylic acid;quinoline has a molecular weight of 259.31 g/mol, XLogP of 0.87, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-2-carboxylic acid;quinoline is sourced from PubChem (CID 160554290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).