About carbonic acid;quinoline
carbonic acid;quinoline (PubChem CID 23206844) has the molecular formula C11H11NO6
and a molecular weight of 253.21 g/mol. Its IUPAC name is carbonic acid;quinoline.
Molecular Properties
| Compound Name | carbonic acid;quinoline |
| PubChem CID | 23206844 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | carbonic acid;quinoline |
| SMILES | O=C(O)O.O=C(O)O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.2CH2O3/c1-2-6-9-8(4-1)5-3-7-10-9;2*2-1(3)4/h1-7H;2*(H2,2,3,4) |
| InChIKey | QHPFRMBYYWGHJL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;quinoline?
The IUPAC name of carbonic acid;quinoline (CID 23206844) is carbonic acid;quinoline.
What is the SMILES notation for carbonic acid;quinoline?
The canonical SMILES for carbonic acid;quinoline is O=C(O)O.O=C(O)O.c1ccc2ncccc2c1.
What is the InChIKey of carbonic acid;quinoline?
The InChIKey is QHPFRMBYYWGHJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.2CH2O3/c1-2-6-9-8(4-1)5-3-7-10-9;2*2-1(3)4/h1-7H;2*(H2,2,3,4).
What are the key properties of carbonic acid;quinoline?
carbonic acid;quinoline has a molecular weight of 253.21 g/mol, XLogP of 2.68, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;quinoline is sourced from PubChem (CID 23206844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).