About acetic acid;quinoline
acetic acid;quinoline (PubChem CID 67159702) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is acetic acid;quinoline.
Molecular Properties
| Compound Name | acetic acid;quinoline |
| PubChem CID | 67159702 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | acetic acid;quinoline |
| SMILES | CC(=O)O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C2H4O2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2(3)4/h1-7H;1H3,(H,3,4) |
| InChIKey | FTMZKLAQERTADZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;quinoline?
The IUPAC name of acetic acid;quinoline (CID 67159702) is acetic acid;quinoline.
What is the SMILES notation for acetic acid;quinoline?
The canonical SMILES for acetic acid;quinoline is CC(=O)O.c1ccc2ncccc2c1.
What is the InChIKey of acetic acid;quinoline?
The InChIKey is FTMZKLAQERTADZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H4O2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2(3)4/h1-7H;1H3,(H,3,4).
What are the key properties of acetic acid;quinoline?
acetic acid;quinoline has a molecular weight of 189.21 g/mol, XLogP of 2.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;quinoline is sourced from PubChem (CID 67159702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).