About 2,2-dichloroacetic acid;quinoline
2,2-dichloroacetic acid;quinoline (PubChem CID 173189076) has the molecular formula C11H9Cl2NO2
and a molecular weight of 258.10 g/mol. Its IUPAC name is 2,2-dichloroacetic acid;quinoline.
Molecular Properties
| Compound Name | 2,2-dichloroacetic acid;quinoline |
| PubChem CID | 173189076 |
| Molecular Formula | C11H9Cl2NO2 |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 2,2-dichloroacetic acid;quinoline |
| SMILES | O=C(O)C(Cl)Cl.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C2H2Cl2O2/c1-2-6-9-8(4-1)5-3-7-10-9;3-1(4)2(5)6/h1-7H;1H,(H,5,6) |
| InChIKey | ZCQLULPFJZGOCC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloroacetic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloroacetic acid;quinoline?
The IUPAC name of 2,2-dichloroacetic acid;quinoline (CID 173189076) is 2,2-dichloroacetic acid;quinoline.
What is the SMILES notation for 2,2-dichloroacetic acid;quinoline?
The canonical SMILES for 2,2-dichloroacetic acid;quinoline is O=C(O)C(Cl)Cl.c1ccc2ncccc2c1.
What is the InChIKey of 2,2-dichloroacetic acid;quinoline?
The InChIKey is ZCQLULPFJZGOCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H2Cl2O2/c1-2-6-9-8(4-1)5-3-7-10-9;3-1(4)2(5)6/h1-7H;1H,(H,5,6).
What are the key properties of 2,2-dichloroacetic acid;quinoline?
2,2-dichloroacetic acid;quinoline has a molecular weight of 258.10 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloroacetic acid;quinoline is sourced from PubChem (CID 173189076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).