About piperazine-2-carboxamide;1H-pyrrole;hydrochloride
piperazine-2-carboxamide;1H-pyrrole;hydrochloride (PubChem CID 174816364) has the molecular formula C9H17ClN4O
and a molecular weight of 232.72 g/mol. Its IUPAC name is piperazine-2-carboxamide;1H-pyrrole;hydrochloride.
Molecular Properties
| Compound Name | piperazine-2-carboxamide;1H-pyrrole;hydrochloride |
| PubChem CID | 174816364 |
| Molecular Formula | C9H17ClN4O |
| Molecular Weight | 232.72 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | piperazine-2-carboxamide;1H-pyrrole;hydrochloride |
| SMILES | Cl.NC(=O)C1CNCCN1.c1cc[nH]c1 |
| InChI | InChI=1S/C5H11N3O.C4H5N.ClH/c6-5(9)4-3-7-1-2-8-4;1-2-4-5-3-1;/h4,7-8H,1-3H2,(H2,6,9);1-5H;1H |
| InChIKey | FDZONEFZBIHFLH-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.72 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperazine-2-carboxamide;1H-pyrrole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-2-carboxamide;1H-pyrrole;hydrochloride?
The IUPAC name of piperazine-2-carboxamide;1H-pyrrole;hydrochloride (CID 174816364) is piperazine-2-carboxamide;1H-pyrrole;hydrochloride.
What is the SMILES notation for piperazine-2-carboxamide;1H-pyrrole;hydrochloride?
The canonical SMILES for piperazine-2-carboxamide;1H-pyrrole;hydrochloride is Cl.NC(=O)C1CNCCN1.c1cc[nH]c1.
What is the InChIKey of piperazine-2-carboxamide;1H-pyrrole;hydrochloride?
The InChIKey is FDZONEFZBIHFLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O.C4H5N.ClH/c6-5(9)4-3-7-1-2-8-4;1-2-4-5-3-1;/h4,7-8H,1-3H2,(H2,6,9);1-5H;1H.
What are the key properties of piperazine-2-carboxamide;1H-pyrrole;hydrochloride?
piperazine-2-carboxamide;1H-pyrrole;hydrochloride has a molecular weight of 232.72 g/mol, XLogP of -0.53, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-2-carboxamide;1H-pyrrole;hydrochloride is sourced from PubChem (CID 174816364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).