About piperazine;1H-pyrrole
piperazine;1H-pyrrole (PubChem CID 160573516) has the molecular formula C12H25N5
and a molecular weight of 239.37 g/mol. Its IUPAC name is piperazine;1H-pyrrole.
Molecular Properties
| Compound Name | piperazine;1H-pyrrole |
| PubChem CID | 160573516 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | piperazine;1H-pyrrole |
| SMILES | C1CNCCN1.C1CNCCN1.c1cc[nH]c1 |
| InChI | InChI=1S/2C4H10N2.C4H5N/c2*1-2-6-4-3-5-1;1-2-4-5-3-1/h2*5-6H,1-4H2;1-5H |
| InChIKey | RAVOUZNZLSBQTN-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;1H-pyrrole?
The IUPAC name of piperazine;1H-pyrrole (CID 160573516) is piperazine;1H-pyrrole.
What is the SMILES notation for piperazine;1H-pyrrole?
The canonical SMILES for piperazine;1H-pyrrole is C1CNCCN1.C1CNCCN1.c1cc[nH]c1.
What is the InChIKey of piperazine;1H-pyrrole?
The InChIKey is RAVOUZNZLSBQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H10N2.C4H5N/c2*1-2-6-4-3-5-1;1-2-4-5-3-1/h2*5-6H,1-4H2;1-5H.
What are the key properties of piperazine;1H-pyrrole?
piperazine;1H-pyrrole has a molecular weight of 239.37 g/mol, XLogP of -0.63, 0 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;1H-pyrrole is sourced from PubChem (CID 160573516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).