About but-1-yne;piperazine;1H-pyrrole
but-1-yne;piperazine;1H-pyrrole (PubChem CID 174849202) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is but-1-yne;piperazine;1H-pyrrole.
Molecular Properties
| Compound Name | but-1-yne;piperazine;1H-pyrrole |
| PubChem CID | 174849202 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | but-1-yne;piperazine;1H-pyrrole |
| SMILES | C#CCC.C1CNCCN1.c1cc[nH]c1 |
| InChI | InChI=1S/C4H10N2.C4H5N.C4H6/c1-2-6-4-3-5-1;1-2-4-5-3-1;1-3-4-2/h5-6H,1-4H2;1-5H;1H,4H2,2H3 |
| InChIKey | MNYRMASVEQSFMV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-1-yne;piperazine;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-yne;piperazine;1H-pyrrole?
The IUPAC name of but-1-yne;piperazine;1H-pyrrole (CID 174849202) is but-1-yne;piperazine;1H-pyrrole.
What is the SMILES notation for but-1-yne;piperazine;1H-pyrrole?
The canonical SMILES for but-1-yne;piperazine;1H-pyrrole is C#CCC.C1CNCCN1.c1cc[nH]c1.
What is the InChIKey of but-1-yne;piperazine;1H-pyrrole?
The InChIKey is MNYRMASVEQSFMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.C4H5N.C4H6/c1-2-6-4-3-5-1;1-2-4-5-3-1;1-3-4-2/h5-6H,1-4H2;1-5H;1H,4H2,2H3.
What are the key properties of but-1-yne;piperazine;1H-pyrrole?
but-1-yne;piperazine;1H-pyrrole has a molecular weight of 207.32 g/mol, XLogP of 1.22, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-yne;piperazine;1H-pyrrole is sourced from PubChem (CID 174849202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).