About 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone
1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone (PubChem CID 22113787) has the molecular formula C11H24N4O
and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone |
| PubChem CID | 22113787 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone |
| SMILES | CC(=O)C1CNCCNCCN(C)CCN1 |
| InChI | InChI=1S/C11H24N4O/c1-10(16)11-9-13-4-3-12-5-7-15(2)8-6-14-11/h11-14H,3-9H2,1-2H3 |
| InChIKey | GHQLOKQODPMCAC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone?
The IUPAC name of 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone (CID 22113787) is 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone.
What is the SMILES notation for 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone?
The canonical SMILES for 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone is CC(=O)C1CNCCNCCN(C)CCN1.
What is the InChIKey of 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone?
The InChIKey is GHQLOKQODPMCAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N4O/c1-10(16)11-9-13-4-3-12-5-7-15(2)8-6-14-11/h11-14H,3-9H2,1-2H3.
What are the key properties of 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone?
1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone has a molecular weight of 228.34 g/mol, XLogP of -1.34, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone is sourced from PubChem (CID 22113787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).