C11H24N4O — CID 22113787
1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone (PubChem CID 22113787) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone.
| Compound Name | 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone |
|---|---|
| PubChem CID | 22113787 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1-(10-methyl-1,4,7,10-tetrazacyclododec-2-yl)ethanone |
| SMILES | CC(=O)C1CNCCNCCN(C)CCN1 |
| InChI | InChI=1S/C11H24N4O/c1-10(16)11-9-13-4-3-12-5-7-15(2)8-6-14-11/h11-14H,3-9H2,1-2H3 |
| InChIKey | GHQLOKQODPMCAC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |