C7H13N3O2 — CID 70008986
1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone (PubChem CID 70008986) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone.
| Compound Name | 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone |
|---|---|
| PubChem CID | 70008986 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone |
| SMILES | CC(=O)C1NCNCN1C(C)=O |
| InChI | InChI=1S/C7H13N3O2/c1-5(11)7-9-3-8-4-10(7)6(2)12/h7-9H,3-4H2,1-2H3 |
| InChIKey | BEIJKXJFOJTZRG-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |