About 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone
1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone (PubChem CID 70008986) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone |
| PubChem CID | 70008986 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone |
| SMILES | CC(=O)C1NCNCN1C(C)=O |
| InChI | InChI=1S/C7H13N3O2/c1-5(11)7-9-3-8-4-10(7)6(2)12/h7-9H,3-4H2,1-2H3 |
| InChIKey | BEIJKXJFOJTZRG-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone?
The IUPAC name of 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone (CID 70008986) is 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone.
What is the SMILES notation for 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone?
The canonical SMILES for 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone is CC(=O)C1NCNCN1C(C)=O.
What is the InChIKey of 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone?
The InChIKey is BEIJKXJFOJTZRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-5(11)7-9-3-8-4-10(7)6(2)12/h7-9H,3-4H2,1-2H3.
What are the key properties of 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone?
1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone has a molecular weight of 171.20 g/mol, XLogP of -1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-acetyl-1,3,5-triazinan-2-yl)ethanone is sourced from PubChem (CID 70008986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).