C11H22 — CID 161356354
(1S)-1,2-di(propan-2-yl)cyclopentane (PubChem CID 161356354) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is (1S)-1,2-di(propan-2-yl)cyclopentane.
| Compound Name | (1S)-1,2-di(propan-2-yl)cyclopentane |
|---|---|
| PubChem CID | 161356354 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | (1S)-1,2-di(propan-2-yl)cyclopentane |
| SMILES | CC(C)C1CCC[C@H]1C(C)C |
| InChI | InChI=1S/C11H22/c1-8(2)10-6-5-7-11(10)9(3)4/h8-11H,5-7H2,1-4H3/t10-,11?/m0/s1 |
| InChIKey | IIZPSBPIVHKGFQ-VUWPPUDQSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |