C9H16F2 — CID 140573475
1,2-difluoro-3-propan-2-ylcyclohexane (PubChem CID 140573475) has the molecular formula C9H16F2 and a molecular weight of 162.22 g/mol. Its IUPAC name is 1,2-difluoro-3-propan-2-ylcyclohexane.
| Compound Name | 1,2-difluoro-3-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 140573475 |
| Molecular Formula | C9H16F2 |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,2-difluoro-3-propan-2-ylcyclohexane |
| SMILES | CC(C)C1CCCC(F)C1F |
| InChI | InChI=1S/C9H16F2/c1-6(2)7-4-3-5-8(10)9(7)11/h6-9H,3-5H2,1-2H3 |
| InChIKey | BCXRPIYGILGGEI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |