C9H16F2O — CID 177300411
(1S,2S,4R,5S)-4,5-difluoro-2-propan-2-ylcyclohexan-1-ol (PubChem CID 177300411) has the molecular formula C9H16F2O and a molecular weight of 178.22 g/mol. Its IUPAC name is (1S,2S,4R,5S)-4,5-difluoro-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2S,4R,5S)-4,5-difluoro-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 177300411 |
| Molecular Formula | C9H16F2O |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (1S,2S,4R,5S)-4,5-difluoro-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)[C@@H]1C[C@@H](F)[C@@H](F)C[C@@H]1O |
| InChI | InChI=1S/C9H16F2O/c1-5(2)6-3-7(10)8(11)4-9(6)12/h5-9,12H,3-4H2,1-2H3/t6-,7+,8-,9-/m0/s1 |
| InChIKey | SNNNWHYSTGRFPT-KZVJFYERSA-N |
| XLogP | 2.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |