C10H20NaO — CID 66630118
CID 66630118 (PubChem CID 66630118) has the molecular formula C10H20NaO and a molecular weight of 179.26 g/mol.
| Compound Name | CID 66630118 |
|---|---|
| PubChem CID | 66630118 |
| Molecular Formula | C10H20NaO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O.[Na] |
| InChI | InChI=1S/C10H20O.Na/c1-7(2)9-5-4-8(3)6-10(9)11;/h7-11H,4-6H2,1-3H3;/t8-,9+,10-;/m1./s1 |
| InChIKey | BLYDRBMKPZHWDI-YMQJAAJZSA-N |
| XLogP | 2.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |