C16H30O4 — CID 134346107
1,3-dioxolan-2-one;5-methyl-2-propan-2-ylcyclohexan-1-ol;prop-1-ene (PubChem CID 134346107) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 1,3-dioxolan-2-one;5-methyl-2-propan-2-ylcyclohexan-1-ol;prop-1-ene.
| Compound Name | 1,3-dioxolan-2-one;5-methyl-2-propan-2-ylcyclohexan-1-ol;prop-1-ene |
|---|---|
| PubChem CID | 134346107 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 1,3-dioxolan-2-one;5-methyl-2-propan-2-ylcyclohexan-1-ol;prop-1-ene |
| SMILES | C=CC.CC1CCC(C(C)C)C(O)C1.O=C1OCCO1 |
| InChI | InChI=1S/C10H20O.C3H4O3.C3H6/c1-7(2)9-5-4-8(3)6-10(9)11;4-3-5-1-2-6-3;1-3-2/h7-11H,4-6H2,1-3H3;1-2H2;3H,1H2,2H3 |
| InChIKey | NYWVBMKSEHSCGO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|