C22H40O3 — CID 22134021
3,7-dimethylocta-1,6-dien-3-yl acetate;5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 22134021) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yl acetate;5-methyl-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yl acetate;5-methyl-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 22134021 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yl acetate;5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | C=CC(C)(CCC=C(C)C)OC(C)=O.CC1CCC(C(C)C)C(O)C1 |
| InChI | InChI=1S/C12H20O2.C10H20O/c1-6-12(5,14-11(4)13)9-7-8-10(2)3;1-7(2)9-5-4-8(3)6-10(9)11/h6,8H,1,7,9H2,2-5H3;7-11H,4-6H2,1-3H3 |
| InChIKey | PUCMPLLBZFDJAJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|