C22H38O3 — CID 174957070
acetic acid;3-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,7-dimethylocta-1,6-diene (PubChem CID 174957070) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is acetic acid;3-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,7-dimethylocta-1,6-diene.
| Compound Name | acetic acid;3-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,7-dimethylocta-1,6-diene |
|---|---|
| PubChem CID | 174957070 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | acetic acid;3-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,7-dimethylocta-1,6-diene |
| SMILES | C=CC(C)(CCC=C(C)C)OC(C)(C=C)CCC=C(C)C.CC(=O)O |
| InChI | InChI=1S/C20H34O.C2H4O2/c1-9-19(7,15-11-13-17(3)4)21-20(8,10-2)16-12-14-18(5)6;1-2(3)4/h9-10,13-14H,1-2,11-12,15-16H2,3-8H3;1H3,(H,3,4) |
| InChIKey | NEUYFPDLGIFLAK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|