C11H22O5 — CID 174785668
carbonic acid;3,7-dimethylocta-1,6-dien-3-ol;hydrate (PubChem CID 174785668) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is carbonic acid;3,7-dimethylocta-1,6-dien-3-ol;hydrate.
| Compound Name | carbonic acid;3,7-dimethylocta-1,6-dien-3-ol;hydrate |
|---|---|
| PubChem CID | 174785668 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | carbonic acid;3,7-dimethylocta-1,6-dien-3-ol;hydrate |
| SMILES | C=CC(C)(O)CCC=C(C)C.O.O=C(O)O |
| InChI | InChI=1S/C10H18O.CH2O3.H2O/c1-5-10(4,11)8-6-7-9(2)3;2-1(3)4;/h5,7,11H,1,6,8H2,2-4H3;(H2,2,3,4);1H2 |
| InChIKey | DVGBCSWMLMKCOY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|