C10H17NO2 — CID 10397471
(2E,6R)-6-hydroxy-2,6-dimethylocta-2,7-dienamide (PubChem CID 10397471) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (2E,6R)-6-hydroxy-2,6-dimethylocta-2,7-dienamide.
| Compound Name | (2E,6R)-6-hydroxy-2,6-dimethylocta-2,7-dienamide |
|---|---|
| PubChem CID | 10397471 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2E,6R)-6-hydroxy-2,6-dimethylocta-2,7-dienamide |
| SMILES | C=C[C@](C)(O)CC/C=C(\C)C(N)=O |
| InChI | InChI=1S/C10H17NO2/c1-4-10(3,13)7-5-6-8(2)9(11)12/h4,6,13H,1,5,7H2,2-3H3,(H2,11,12)/b8-6+/t10-/m0/s1 |
| InChIKey | ZSFBNUBMKXAEFD-PCGIRMHASA-N |
| XLogP | 1.14 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|