C11H20O — CID 38988672
(3S,6E)-3,7-dimethylnona-1,6-dien-3-ol (PubChem CID 38988672) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (3S,6E)-3,7-dimethylnona-1,6-dien-3-ol.
| Compound Name | (3S,6E)-3,7-dimethylnona-1,6-dien-3-ol |
|---|---|
| PubChem CID | 38988672 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3S,6E)-3,7-dimethylnona-1,6-dien-3-ol |
| SMILES | C=C[C@@](C)(O)CC/C=C(\C)CC |
| InChI | InChI=1S/C11H20O/c1-5-10(3)8-7-9-11(4,12)6-2/h6,8,12H,2,5,7,9H2,1,3-4H3/b10-8+/t11-/m1/s1 |
| InChIKey | KRLBLPBPZSSIGH-RJCSOLBVSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|