C32H58O2 — CID 134544188
(6E,14E)-10,11-ditert-butyl-3,7,14,18-tetramethylicosa-1,6,14,19-tetraene-3,18-diol (PubChem CID 134544188) has the molecular formula C32H58O2 and a molecular weight of 474.81 g/mol. Its IUPAC name is (6E,14E)-10,11-ditert-butyl-3,7,14,18-tetramethylicosa-1,6,14,19-tetraene-3,18-diol.
| Compound Name | (6E,14E)-10,11-ditert-butyl-3,7,14,18-tetramethylicosa-1,6,14,19-tetraene-3,18-diol |
|---|---|
| PubChem CID | 134544188 |
| Molecular Formula | C32H58O2 |
| Molecular Weight | 474.81 g/mol |
| Exact Mass | 474.44 |
| IUPAC Name | (6E,14E)-10,11-ditert-butyl-3,7,14,18-tetramethylicosa-1,6,14,19-tetraene-3,18-diol |
| SMILES | C=CC(C)(O)CC/C=C(\C)CCC(C(CC/C(C)=C/CCC(C)(O)C=C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C32H58O2/c1-13-31(11,33)23-15-17-25(3)19-21-27(29(5,6)7)28(30(8,9)10)22-20-26(4)18-16-24-32(12,34)14-2/h13-14,17-18,27-28,33-34H,1-2,15-16,19-24H2,3-12H3/b25-17+,26-18+ |
| InChIKey | CNGFSBAJHDUTMX-RPCRKUJJSA-N |
| XLogP | 9.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.81 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|