C65H126O12 — CID 85221340
3,7,11,15,19,23,27,31,35,39,43,47,51-tridecamethyldopentaconta-1,6,50-triene-3,10,11,15,19,23,27,31,35,39,43,47-dodecol (PubChem CID 85221340) has the molecular formula C65H126O12 and a molecular weight of 1099.71 g/mol. Its IUPAC name is 3,7,11,15,19,23,27,31,35,39,43,47,51-tridecamethyldopentaconta-1,6,50-triene-3,10,11,15,19,23,27,31,35,39,43,47-dodecol.
| Compound Name | 3,7,11,15,19,23,27,31,35,39,43,47,51-tridecamethyldopentaconta-1,6,50-triene-3,10,11,15,19,23,27,31,35,39,43,47-dodecol |
|---|---|
| PubChem CID | 85221340 |
| Molecular Formula | C65H126O12 |
| Molecular Weight | 1099.71 g/mol |
| Exact Mass | 1098.92 |
| IUPAC Name | 3,7,11,15,19,23,27,31,35,39,43,47,51-tridecamethyldopentaconta-1,6,50-triene-3,10,11,15,19,23,27,31,35,39,43,47-dodecol |
| SMILES | C=CC(C)(O)CCC=C(C)CCC(O)C(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C65H126O12/c1-16-55(5,67)32-18-29-53(4)30-31-54(66)65(15,77)51-27-50-64(14,76)49-26-48-63(13,75)47-25-46-62(12,74)45-24-44-61(11,73)43-23-42-60(10,72)41-22-40-59(9,71)39-21-38-58(8,70)37-20-36-57(7,69)35-19-34-56(6,68)33-17-28-52(2)3/h16,28-29,54,66-77H,1,17-27,30-51H2,2-15H3 |
| InChIKey | BHOKARMPSWNIEZ-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 242.76 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 77 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.71 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|