C20H38O — CID 15602246
(6E)-3,7,11,15-tetramethylhexadeca-1,6-dien-3-ol (PubChem CID 15602246) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is (6E)-3,7,11,15-tetramethylhexadeca-1,6-dien-3-ol.
| Compound Name | (6E)-3,7,11,15-tetramethylhexadeca-1,6-dien-3-ol |
|---|---|
| PubChem CID | 15602246 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | (6E)-3,7,11,15-tetramethylhexadeca-1,6-dien-3-ol |
| SMILES | C=CC(C)(O)CC/C=C(\C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H38O/c1-7-20(6,21)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h7,15,17-18,21H,1,8-14,16H2,2-6H3/b19-15+ |
| InChIKey | YMNVJBIMJQLKJJ-XDJHFCHBSA-N |
| XLogP | 6.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|