C17H28O3 — CID 57042220
11-hydroxy-1-methoxy-3,7,11-trimethyltrideca-3,7,12-trien-2-one (PubChem CID 57042220) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 11-hydroxy-1-methoxy-3,7,11-trimethyltrideca-3,7,12-trien-2-one.
| Compound Name | 11-hydroxy-1-methoxy-3,7,11-trimethyltrideca-3,7,12-trien-2-one |
|---|---|
| PubChem CID | 57042220 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 11-hydroxy-1-methoxy-3,7,11-trimethyltrideca-3,7,12-trien-2-one |
| SMILES | C=CC(C)(O)CCC=C(C)CCC=C(C)C(=O)COC |
| InChI | InChI=1S/C17H28O3/c1-6-17(4,19)12-8-10-14(2)9-7-11-15(3)16(18)13-20-5/h6,10-11,19H,1,7-9,12-13H2,2-5H3 |
| InChIKey | OBRPRCASPSBCMW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|